C23H27NO6S — CID 59740400
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-propan-2-yloxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol (PubChem CID 59740400) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-propan-2-yloxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-propan-2-yloxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 59740400 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-(4-propan-2-yloxyphenyl)sulfanylindol-1-yl]oxane-3,4,5-triol |
| SMILES | CC(C)Oc1ccc(Sc2cn([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c3ccccc23)cc1 |
| InChI | InChI=1S/C23H27NO6S/c1-13(2)29-14-7-9-15(10-8-14)31-19-11-24(17-6-4-3-5-16(17)19)23-22(28)21(27)20(26)18(12-25)30-23/h3-11,13,18,20-23,25-28H,12H2,1-2H3/t18-,20-,21+,22-,23-/m1/s1 |
| InChIKey | PDNJPDKZXUVUNR-DODNOZFWSA-N |
| XLogP | 2.55 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |