About (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone
(5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone (PubChem CID 59740561) has the molecular formula C24H26N2O3
and a molecular weight of 390.48 g/mol. Its IUPAC name is (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone.
Molecular Properties
| Compound Name | (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone |
| PubChem CID | 59740561 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone |
| SMILES | CC(C)Oc1ccc2[nH]c(C(=O)N3CCC4(CC3)COc3ccccc34)cc2c1 |
| InChI | InChI=1S/C24H26N2O3/c1-16(2)29-18-7-8-20-17(13-18)14-21(25-20)23(27)26-11-9-24(10-12-26)15-28-22-6-4-3-5-19(22)24/h3-8,13-14,16,25H,9-12,15H2,1-2H3 |
| InChIKey | POEGDYPRAVMHRS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The IUPAC name of (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone (CID 59740561) is (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone.
What is the SMILES notation for (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The canonical SMILES for (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone is CC(C)Oc1ccc2[nH]c(C(=O)N3CCC4(CC3)COc3ccccc34)cc2c1.
What is the InChIKey of (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
The InChIKey is POEGDYPRAVMHRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O3/c1-16(2)29-18-7-8-20-17(13-18)14-21(25-20)23(27)26-11-9-24(10-12-26)15-28-22-6-4-3-5-19(22)24/h3-8,13-14,16,25H,9-12,15H2,1-2H3.
What are the key properties of (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone?
(5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone has a molecular weight of 390.48 g/mol, XLogP of 4.52, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-propan-2-yloxy-1H-indol-2-yl)-spiro[2H-1-benzofuran-3,4'-piperidine]-1'-ylmethanone is sourced from PubChem (CID 59740561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).