C20H16ClFN2O2 — CID 59740726
N-(3-chlorophenyl)-N-[(8-fluoro-2-oxo-1H-quinolin-4-yl)methyl]cyclopropanecarboxamide (PubChem CID 59740726) has the molecular formula C20H16ClFN2O2 and a molecular weight of 370.81 g/mol. Its IUPAC name is N-(3-chlorophenyl)-N-[(8-fluoro-2-oxo-1H-quinolin-4-yl)methyl]cyclopropanecarboxamide.
| Compound Name | N-(3-chlorophenyl)-N-[(8-fluoro-2-oxo-1H-quinolin-4-yl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 59740726 |
| Molecular Formula | C20H16ClFN2O2 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N-(3-chlorophenyl)-N-[(8-fluoro-2-oxo-1H-quinolin-4-yl)methyl]cyclopropanecarboxamide |
| SMILES | O=C(C1CC1)N(Cc1cc(=O)[nH]c2c(F)cccc12)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClFN2O2/c21-14-3-1-4-15(10-14)24(20(26)12-7-8-12)11-13-9-18(25)23-19-16(13)5-2-6-17(19)22/h1-6,9-10,12H,7-8,11H2,(H,23,25) |
| InChIKey | NMCHEXFWCDVSSB-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |