C22H25F2NO3S — CID 59741048
methyl (3S)-8-(3,4-difluorophenyl)-7-heptyl-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate (PubChem CID 59741048) has the molecular formula C22H25F2NO3S and a molecular weight of 421.51 g/mol. Its IUPAC name is methyl (3S)-8-(3,4-difluorophenyl)-7-heptyl-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate.
| Compound Name | methyl (3S)-8-(3,4-difluorophenyl)-7-heptyl-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59741048 |
| Molecular Formula | C22H25F2NO3S |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | methyl (3S)-8-(3,4-difluorophenyl)-7-heptyl-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
| SMILES | CCCCCCCc1cc(=O)n2c(c1-c1ccc(F)c(F)c1)SC[C@@H]2C(=O)OC |
| InChI | InChI=1S/C22H25F2NO3S/c1-3-4-5-6-7-8-14-12-19(26)25-18(22(27)28-2)13-29-21(25)20(14)15-9-10-16(23)17(24)11-15/h9-12,18H,3-8,13H2,1-2H3/t18-/m1/s1 |
| InChIKey | XVWGWHXTAOOZTF-GOSISDBHSA-N |
| XLogP | 5.13 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|