C20H25NO3S2 — CID 59741056
methyl (3R)-7-heptyl-5-oxo-8-thiophen-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate (PubChem CID 59741056) has the molecular formula C20H25NO3S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is methyl (3R)-7-heptyl-5-oxo-8-thiophen-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate.
| Compound Name | methyl (3R)-7-heptyl-5-oxo-8-thiophen-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59741056 |
| Molecular Formula | C20H25NO3S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | methyl (3R)-7-heptyl-5-oxo-8-thiophen-2-yl-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylate |
| SMILES | CCCCCCCc1cc(=O)n2c(c1-c1cccs1)SC[C@H]2C(=O)OC |
| InChI | InChI=1S/C20H25NO3S2/c1-3-4-5-6-7-9-14-12-17(22)21-15(20(23)24-2)13-26-19(21)18(14)16-10-8-11-25-16/h8,10-12,15H,3-7,9,13H2,1-2H3/t15-/m0/s1 |
| InChIKey | NOJDDJPIVISLJZ-HNNXBMFYSA-N |
| XLogP | 4.91 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|