C20H26N2O2 — CID 59741083
4-[2-[(5aS,9bR)-5a,9b-dimethyl-7-methylidene-4,5,6,8,9,9a-hexahydrobenzo[e]indazol-6-yl]ethyl]-2H-furan-5-one (PubChem CID 59741083) has the molecular formula C20H26N2O2 and a molecular weight of 326.44 g/mol. Its IUPAC name is 4-[2-[(5aS,9bR)-5a,9b-dimethyl-7-methylidene-4,5,6,8,9,9a-hexahydrobenzo[e]indazol-6-yl]ethyl]-2H-furan-5-one.
| Compound Name | 4-[2-[(5aS,9bR)-5a,9b-dimethyl-7-methylidene-4,5,6,8,9,9a-hexahydrobenzo[e]indazol-6-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 59741083 |
| Molecular Formula | C20H26N2O2 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | 4-[2-[(5aS,9bR)-5a,9b-dimethyl-7-methylidene-4,5,6,8,9,9a-hexahydrobenzo[e]indazol-6-yl]ethyl]-2H-furan-5-one |
| SMILES | C=C1CCC2[C@@](C)(CCC3=NN=C[C@]32C)C1CCC1=CCOC1=O |
| InChI | InChI=1S/C20H26N2O2/c1-13-4-7-16-19(2,10-8-17-20(16,3)12-21-22-17)15(13)6-5-14-9-11-24-18(14)23/h9,12,15-16H,1,4-8,10-11H2,2-3H3/t15?,16?,19-,20-/m0/s1 |
| InChIKey | SSHRTXRHEVCIEJ-PNGKTBNWSA-N |
| XLogP | 4.08 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|