C14H16O5 — CID 597412
11-ethylidene-6-methoxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one (PubChem CID 597412) has the molecular formula C14H16O5 and a molecular weight of 264.28 g/mol. Its IUPAC name is 11-ethylidene-6-methoxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one.
| Compound Name | 11-ethylidene-6-methoxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one |
|---|---|
| PubChem CID | 597412 |
| Molecular Formula | C14H16O5 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 11-ethylidene-6-methoxy-7,9,13-trioxatetracyclo[6.5.1.01,10.04,14]tetradec-2-en-12-one |
| SMILES | CC=C1C(=O)OC23C=CC4CC(OC)OC(OC12)C43 |
| InChI | InChI=1S/C14H16O5/c1-3-8-11-14(19-12(8)15)5-4-7-6-9(16-2)17-13(18-11)10(7)14/h3-5,7,9-11,13H,6H2,1-2H3 |
| InChIKey | WZVNVBISBZZBTD-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|