C15H22F4O4 — CID 59741541
2,2,2-trifluoroethyl 2-fluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate (PubChem CID 59741541) has the molecular formula C15H22F4O4 and a molecular weight of 342.33 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-fluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate.
| Compound Name | 2,2,2-trifluoroethyl 2-fluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate |
|---|---|
| PubChem CID | 59741541 |
| Molecular Formula | C15H22F4O4 |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-fluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate |
| SMILES | CC1OC2CCCCC2OC1CC(C)(F)C(=O)OCC(F)(F)F |
| InChI | InChI=1S/C15H22F4O4/c1-9-12(23-11-6-4-3-5-10(11)22-9)7-14(2,16)13(20)21-8-15(17,18)19/h9-12H,3-8H2,1-2H3 |
| InChIKey | PSBRILRTVSOBJX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |