C10H14F6O2 — CID 59741553
2-(3,3,4,4,5,5-hexafluoropentyl)-3-methyl-1,4-dioxane (PubChem CID 59741553) has the molecular formula C10H14F6O2 and a molecular weight of 280.21 g/mol. Its IUPAC name is 2-(3,3,4,4,5,5-hexafluoropentyl)-3-methyl-1,4-dioxane.
| Compound Name | 2-(3,3,4,4,5,5-hexafluoropentyl)-3-methyl-1,4-dioxane |
|---|---|
| PubChem CID | 59741553 |
| Molecular Formula | C10H14F6O2 |
| Molecular Weight | 280.21 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(3,3,4,4,5,5-hexafluoropentyl)-3-methyl-1,4-dioxane |
| SMILES | CC1OCCOC1CCC(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C10H14F6O2/c1-6-7(18-5-4-17-6)2-3-9(13,14)10(15,16)8(11)12/h6-8H,2-5H2,1H3 |
| InChIKey | ZTKDRHNCZNIBBG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|