C17H23F7O4 — CID 59741568
2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate (PubChem CID 59741568) has the molecular formula C17H23F7O4 and a molecular weight of 424.35 g/mol. Its IUPAC name is 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate.
| Compound Name | 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate |
|---|---|
| PubChem CID | 59741568 |
| Molecular Formula | C17H23F7O4 |
| Molecular Weight | 424.35 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2,2,3,3-tetrafluoropropyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate |
| SMILES | CC1OC2CCCCC2OC1CC(C)(C(=O)OCC(F)(F)C(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H23F7O4/c1-9-12(28-11-6-4-3-5-10(11)27-9)7-15(2,17(22,23)24)14(25)26-8-16(20,21)13(18)19/h9-13H,3-8H2,1-2H3 |
| InChIKey | WXSOYOLMIUZDHN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|