C15H23F3O4 — CID 59741579
methyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate (PubChem CID 59741579) has the molecular formula C15H23F3O4 and a molecular weight of 324.34 g/mol. Its IUPAC name is methyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate.
| Compound Name | methyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate |
|---|---|
| PubChem CID | 59741579 |
| Molecular Formula | C15H23F3O4 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | methyl 3,3,3-trifluoro-2-methyl-2-[(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)methyl]propanoate |
| SMILES | COC(=O)C(C)(CC1OC2CCCCC2OC1C)C(F)(F)F |
| InChI | InChI=1S/C15H23F3O4/c1-9-12(22-11-7-5-4-6-10(11)21-9)8-14(2,13(19)20-3)15(16,17)18/h9-12H,4-8H2,1-3H3 |
| InChIKey | FUNUQVQIVCGMGI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |