C14H22F2O4 — CID 59741589
methyl 2,3-difluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate (PubChem CID 59741589) has the molecular formula C14H22F2O4 and a molecular weight of 292.32 g/mol. Its IUPAC name is methyl 2,3-difluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate.
| Compound Name | methyl 2,3-difluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate |
|---|---|
| PubChem CID | 59741589 |
| Molecular Formula | C14H22F2O4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | methyl 2,3-difluoro-2-methyl-3-(2-methyl-2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]dioxin-3-yl)propanoate |
| SMILES | COC(=O)C(C)(F)C(F)C1OC2CCCCC2OC1C |
| InChI | InChI=1S/C14H22F2O4/c1-8-11(12(15)14(2,16)13(17)18-3)20-10-7-5-4-6-9(10)19-8/h8-12H,4-7H2,1-3H3 |
| InChIKey | JRLBKXNKGJLQSC-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |