C8H13FO2 — CID 59741611
(3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-one (PubChem CID 59741611) has the molecular formula C8H13FO2 and a molecular weight of 160.19 g/mol. Its IUPAC name is (3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-one.
| Compound Name | (3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 59741611 |
| Molecular Formula | C8H13FO2 |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.09 |
| IUPAC Name | (3R,4R,5R)-5-ethyl-3-fluoro-3,4-dimethyloxolan-2-one |
| SMILES | CC[C@H]1OC(=O)[C@](C)(F)[C@@H]1C |
| InChI | InChI=1S/C8H13FO2/c1-4-6-5(2)8(3,9)7(10)11-6/h5-6H,4H2,1-3H3/t5-,6-,8-/m1/s1 |
| InChIKey | KPZDSZTWCLVXRS-ATRFCDNQSA-N |
| XLogP | 1.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |