C26H7F9S — CID 59741730
16,17,18,19-tetrafluoro-7-(2,3,4,5,6-pentafluorophenyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15(20),16,18-decaene (PubChem CID 59741730) has the molecular formula C26H7F9S and a molecular weight of 522.39 g/mol. Its IUPAC name is 16,17,18,19-tetrafluoro-7-(2,3,4,5,6-pentafluorophenyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15(20),16,18-decaene.
| Compound Name | 16,17,18,19-tetrafluoro-7-(2,3,4,5,6-pentafluorophenyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15(20),16,18-decaene |
|---|---|
| PubChem CID | 59741730 |
| Molecular Formula | C26H7F9S |
| Molecular Weight | 522.39 g/mol |
| Exact Mass | 522.01 |
| IUPAC Name | 16,17,18,19-tetrafluoro-7-(2,3,4,5,6-pentafluorophenyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15(20),16,18-decaene |
| SMILES | Fc1c(F)c(F)c(-c2cc3cc4cc5cc6c(F)c(F)c(F)c(F)c6cc5cc4cc3s2)c(F)c1F |
| InChI | InChI=1S/C26H7F9S/c27-18-13-4-9-1-8-3-12-7-16(17-20(29)24(33)26(35)25(34)21(17)30)36-15(12)6-11(8)2-10(9)5-14(13)19(28)23(32)22(18)31/h1-7H |
| InChIKey | BZRSMXQPROFQPO-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.39 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|