About 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline
4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline (PubChem CID 59741877) has the molecular formula C26H20N2O5S2
and a molecular weight of 504.59 g/mol. Its IUPAC name is 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline.
Molecular Properties
| Compound Name | 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline |
| PubChem CID | 59741877 |
| Molecular Formula | C26H20N2O5S2 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.08 |
| IUPAC Name | 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline |
| SMILES | COOOSc1ccc(-c2ccnc3c2ccc2c(-c4ccc(S(C)(=O)=O)cc4)ccnc23)cc1 |
| InChI | InChI=1S/C26H20N2O5S2/c1-31-32-33-34-19-7-3-17(4-8-19)21-13-15-27-25-23(21)11-12-24-22(14-16-28-26(24)25)18-5-9-20(10-6-18)35(2,29)30/h3-16H,1-2H3 |
| InChIKey | HLPZQORNWNXQAR-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline?
The IUPAC name of 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline (CID 59741877) is 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline.
What is the SMILES notation for 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline?
The canonical SMILES for 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline is COOOSc1ccc(-c2ccnc3c2ccc2c(-c4ccc(S(C)(=O)=O)cc4)ccnc23)cc1.
What is the InChIKey of 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline?
The InChIKey is HLPZQORNWNXQAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O5S2/c1-31-32-33-34-19-7-3-17(4-8-19)21-13-15-27-25-23(21)11-12-24-22(14-16-28-26(24)25)18-5-9-20(10-6-18)35(2,29)30/h3-16H,1-2H3.
What are the key properties of 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline?
4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline has a molecular weight of 504.59 g/mol, XLogP of 6.04, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyperoxysulfanylphenyl)-7-(4-methylsulfonylphenyl)-1,10-phenanthroline is sourced from PubChem (CID 59741877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).