About spiro[4.5]deca-1,3,7,9-tetraene
spiro[4.5]deca-1,3,7,9-tetraene (PubChem CID 59741992) has the molecular formula C10H10
and a molecular weight of 130.19 g/mol. Its IUPAC name is spiro[4.5]deca-1,3,7,9-tetraene.
Molecular Properties
| Compound Name | spiro[4.5]deca-1,3,7,9-tetraene |
| PubChem CID | 59741992 |
| Molecular Formula | C10H10 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.08 |
| IUPAC Name | spiro[4.5]deca-1,3,7,9-tetraene |
| SMILES | C1=CCC2(C=C1)C=CC=C2 |
| InChI | InChI=1S/C10H10/c1-2-6-10(7-3-1)8-4-5-9-10/h1-6,8-9H,7H2 |
| InChIKey | PFQKGSCSIQKRPQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[4.5]deca-1,3,7,9-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.5]deca-1,3,7,9-tetraene?
The IUPAC name of spiro[4.5]deca-1,3,7,9-tetraene (CID 59741992) is spiro[4.5]deca-1,3,7,9-tetraene.
What is the SMILES notation for spiro[4.5]deca-1,3,7,9-tetraene?
The canonical SMILES for spiro[4.5]deca-1,3,7,9-tetraene is C1=CCC2(C=C1)C=CC=C2.
What is the InChIKey of spiro[4.5]deca-1,3,7,9-tetraene?
The InChIKey is PFQKGSCSIQKRPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10/c1-2-6-10(7-3-1)8-4-5-9-10/h1-6,8-9H,7H2.
What are the key properties of spiro[4.5]deca-1,3,7,9-tetraene?
spiro[4.5]deca-1,3,7,9-tetraene has a molecular weight of 130.19 g/mol, XLogP of 2.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.5]deca-1,3,7,9-tetraene is sourced from PubChem (CID 59741992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).