C13H18 — CID 59742037
spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-cyclopenta-1,3-diene] (PubChem CID 59742037) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-cyclopenta-1,3-diene].
| Compound Name | spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-cyclopenta-1,3-diene] |
|---|---|
| PubChem CID | 59742037 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | spiro[1,3,3a,4,5,6,7,7a-octahydroindene-2,5'-cyclopenta-1,3-diene] |
| SMILES | C1=CC2(C=C1)CC1CCCCC1C2 |
| InChI | InChI=1S/C13H18/c1-2-6-12-10-13(7-3-4-8-13)9-11(12)5-1/h3-4,7-8,11-12H,1-2,5-6,9-10H2 |
| InChIKey | QSNWGLNTERIJLP-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |