About spiro[4.14]nonadeca-1,3-diene
spiro[4.14]nonadeca-1,3-diene (PubChem CID 59742110) has the molecular formula C19H32
and a molecular weight of 260.46 g/mol. Its IUPAC name is spiro[4.14]nonadeca-1,3-diene.
Molecular Properties
| Compound Name | spiro[4.14]nonadeca-1,3-diene |
| PubChem CID | 59742110 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | spiro[4.14]nonadeca-1,3-diene |
| SMILES | C1=CC2(C=C1)CCCCCCCCCCCCCC2 |
| InChI | InChI=1S/C19H32/c1-2-4-6-8-10-12-16-19(17-13-14-18-19)15-11-9-7-5-3-1/h13-14,17-18H,1-12,15-16H2 |
| InChIKey | YUMZMXLOPMOSJW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze spiro[4.14]nonadeca-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[4.14]nonadeca-1,3-diene?
The IUPAC name of spiro[4.14]nonadeca-1,3-diene (CID 59742110) is spiro[4.14]nonadeca-1,3-diene.
What is the SMILES notation for spiro[4.14]nonadeca-1,3-diene?
The canonical SMILES for spiro[4.14]nonadeca-1,3-diene is C1=CC2(C=C1)CCCCCCCCCCCCCC2.
What is the InChIKey of spiro[4.14]nonadeca-1,3-diene?
The InChIKey is YUMZMXLOPMOSJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32/c1-2-4-6-8-10-12-16-19(17-13-14-18-19)15-11-9-7-5-3-1/h13-14,17-18H,1-12,15-16H2.
What are the key properties of spiro[4.14]nonadeca-1,3-diene?
spiro[4.14]nonadeca-1,3-diene has a molecular weight of 260.46 g/mol, XLogP of 6.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[4.14]nonadeca-1,3-diene is sourced from PubChem (CID 59742110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).