C44H33F6N3O3 — CID 59742425
6-[1,1-bis[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazine (PubChem CID 59742425) has the molecular formula C44H33F6N3O3 and a molecular weight of 765.75 g/mol. Its IUPAC name is 6-[1,1-bis[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 6-[1,1-bis[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 59742425 |
| Molecular Formula | C44H33F6N3O3 |
| Molecular Weight | 765.75 g/mol |
| Exact Mass | 765.24 |
| IUPAC Name | 6-[1,1-bis[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]ethyl]-3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(c1ccc2c(c1)CN(c1ccc(F)cc1F)CO2)(c1ccc2c(c1)CN(c1ccc(F)cc1F)CO2)c1ccc2c(c1)CN(c1ccc(F)cc1F)CO2 |
| InChI | InChI=1S/C44H33F6N3O3/c1-44(29-2-11-41-26(14-29)20-51(23-54-41)38-8-5-32(45)17-35(38)48,30-3-12-42-27(15-30)21-52(24-55-42)39-9-6-33(46)18-36(39)49)31-4-13-43-28(16-31)22-53(25-56-43)40-10-7-34(47)19-37(40)50/h2-19H,20-25H2,1H3 |
| InChIKey | NVYADKLXZPUENU-UHFFFAOYSA-N |
| XLogP | 9.94 |
| TPSA | 37.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.75 |
| LogP ≤ 5 | 9.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|