C31H26F4N2O2 — CID 59742426
3-(2,4-difluorophenyl)-6-[2-[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine (PubChem CID 59742426) has the molecular formula C31H26F4N2O2 and a molecular weight of 534.55 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)-6-[2-[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine.
| Compound Name | 3-(2,4-difluorophenyl)-6-[2-[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
|---|---|
| PubChem CID | 59742426 |
| Molecular Formula | C31H26F4N2O2 |
| Molecular Weight | 534.55 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | 3-(2,4-difluorophenyl)-6-[2-[3-(2,4-difluorophenyl)-2,4-dihydro-1,3-benzoxazin-6-yl]propan-2-yl]-2,4-dihydro-1,3-benzoxazine |
| SMILES | CC(C)(c1ccc2c(c1)CN(c1ccc(F)cc1F)CO2)c1ccc2c(c1)CN(c1ccc(F)cc1F)CO2 |
| InChI | InChI=1S/C31H26F4N2O2/c1-31(2,21-3-9-29-19(11-21)15-36(17-38-29)27-7-5-23(32)13-25(27)34)22-4-10-30-20(12-22)16-37(18-39-30)28-8-6-24(33)14-26(28)35/h3-14H,15-18H2,1-2H3 |
| InChIKey | NKJNSFBKIYOPJR-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.55 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |