About [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate
[(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate (PubChem CID 59743070) has the molecular formula C20H31ClO4Si
and a molecular weight of 399.00 g/mol. Its IUPAC name is [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate.
Molecular Properties
| Compound Name | [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate |
| PubChem CID | 59743070 |
| Molecular Formula | C20H31ClO4Si |
| Molecular Weight | 399.00 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate |
| SMILES | C=CC[C@@H](C)OC(=O)c1c(OCOCC[Si](C)(C)C)cc(C)c(Cl)c1C |
| InChI | InChI=1S/C20H31ClO4Si/c1-8-9-15(3)25-20(22)18-16(4)19(21)14(2)12-17(18)24-13-23-10-11-26(5,6)7/h8,12,15H,1,9-11,13H2,2-7H3/t15-/m1/s1 |
| InChIKey | AJPYOGSDBUZECU-OAHLLOKOSA-N |
| XLogP | 5.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.00 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate?
The IUPAC name of [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate (CID 59743070) is [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate.
What is the SMILES notation for [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate?
The canonical SMILES for [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate is C=CC[C@@H](C)OC(=O)c1c(OCOCC[Si](C)(C)C)cc(C)c(Cl)c1C.
What is the InChIKey of [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate?
The InChIKey is AJPYOGSDBUZECU-OAHLLOKOSA-N. The full InChI is InChI=1S/C20H31ClO4Si/c1-8-9-15(3)25-20(22)18-16(4)19(21)14(2)12-17(18)24-13-23-10-11-26(5,6)7/h8,12,15H,1,9-11,13H2,2-7H3/t15-/m1/s1.
What are the key properties of [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate?
[(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate has a molecular weight of 399.00 g/mol, XLogP of 5.77, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-pent-4-en-2-yl] 3-chloro-2,4-dimethyl-6-(2-trimethylsilylethoxymethoxy)benzoate is sourced from PubChem (CID 59743070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).