C18H22O7 — CID 59743074
(4R,10E)-6,7,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione (PubChem CID 59743074) has the molecular formula C18H22O7 and a molecular weight of 350.37 g/mol. Its IUPAC name is (4R,10E)-6,7,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione.
| Compound Name | (4R,10E)-6,7,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione |
|---|---|
| PubChem CID | 59743074 |
| Molecular Formula | C18H22O7 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | (4R,10E)-6,7,16,18-tetrahydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),10,15,17-tetraene-2,12-dione |
| SMILES | C[C@@H]1CC(O)C(O)CC/C=C/C(=O)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H22O7/c1-10-6-15(22)14(21)5-3-2-4-12(19)7-11-8-13(20)9-16(23)17(11)18(24)25-10/h2,4,8-10,14-15,20-23H,3,5-7H2,1H3/b4-2+/t10-,14?,15?/m1/s1 |
| InChIKey | PZXNDSUWOROXEX-ARGDLDOYSA-N |
| XLogP | 1.22 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |