C27H37NO3Si — CID 59743081
(2E,6E)-9-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylnona-2,6-dienamide (PubChem CID 59743081) has the molecular formula C27H37NO3Si and a molecular weight of 451.68 g/mol. Its IUPAC name is (2E,6E)-9-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylnona-2,6-dienamide.
| Compound Name | (2E,6E)-9-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylnona-2,6-dienamide |
|---|---|
| PubChem CID | 59743081 |
| Molecular Formula | C27H37NO3Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (2E,6E)-9-[tert-butyl(diphenyl)silyl]oxy-N-methoxy-N-methylnona-2,6-dienamide |
| SMILES | CON(C)C(=O)/C=C/CC/C=C/CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C27H37NO3Si/c1-27(2,3)32(24-18-12-10-13-19-24,25-20-14-11-15-21-25)31-23-17-9-7-6-8-16-22-26(29)28(4)30-5/h7,9-16,18-22H,6,8,17,23H2,1-5H3/b9-7+,22-16+ |
| InChIKey | GBSBMQOVCDLVQO-HQYGPNSOSA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|