C27H37N5O4S — CID 59743445
N,N-diethyl-4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide (PubChem CID 59743445) has the molecular formula C27H37N5O4S and a molecular weight of 527.69 g/mol. Its IUPAC name is N,N-diethyl-4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide.
| Compound Name | N,N-diethyl-4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 59743445 |
| Molecular Formula | C27H37N5O4S |
| Molecular Weight | 527.69 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | N,N-diethyl-4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1CCC(Nc2nccc(-n3ccc4c(OCCCS(C)(=O)=O)cccc43)n2)CC1 |
| InChI | InChI=1S/C27H37N5O4S/c1-4-31(5-2)26(33)20-10-12-21(13-11-20)29-27-28-16-14-25(30-27)32-17-15-22-23(32)8-6-9-24(22)36-18-7-19-37(3,34)35/h6,8-9,14-17,20-21H,4-5,7,10-13,18-19H2,1-3H3,(H,28,29,30) |
| InChIKey | BXZQZGKOTDCAKN-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.69 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|