C27H35N5O5S — CID 59743507
[(3R)-3-hydroxypyrrolidin-1-yl]-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone (PubChem CID 59743507) has the molecular formula C27H35N5O5S and a molecular weight of 541.67 g/mol. Its IUPAC name is [(3R)-3-hydroxypyrrolidin-1-yl]-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone.
| Compound Name | [(3R)-3-hydroxypyrrolidin-1-yl]-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
|---|---|
| PubChem CID | 59743507 |
| Molecular Formula | C27H35N5O5S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.24 |
| IUPAC Name | [(3R)-3-hydroxypyrrolidin-1-yl]-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexyl]methanone |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2-c1ccnc(NC2CCC(C(=O)N3CC[C@@H](O)C3)CC2)n1 |
| InChI | InChI=1S/C27H35N5O5S/c1-38(35,36)17-3-16-37-24-5-2-4-23-22(24)12-15-32(23)25-10-13-28-27(30-25)29-20-8-6-19(7-9-20)26(34)31-14-11-21(33)18-31/h2,4-5,10,12-13,15,19-21,33H,3,6-9,11,14,16-18H2,1H3,(H,28,29,30)/t19?,20?,21-/m1/s1 |
| InChIKey | JOAJAXWKPSMMPG-XVAXZDLZSA-N |
| XLogP | 2.80 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|