About 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol
3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol (PubChem CID 59743549) has the molecular formula C20H25N5O4
and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol.
Molecular Properties
| Compound Name | 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol |
| PubChem CID | 59743549 |
| Molecular Formula | C20H25N5O4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol |
| SMILES | OCC(O)COc1cccc2c1cnn2-c1ccnc(NC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C20H25N5O4/c26-11-15(28)12-29-18-3-1-2-17-16(18)10-22-25(17)19-8-9-21-20(24-19)23-13-4-6-14(27)7-5-13/h1-3,8-10,13-15,26-28H,4-7,11-12H2,(H,21,23,24) |
| InChIKey | ATAFJTOBINKREW-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 125.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol?
The IUPAC name of 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol (CID 59743549) is 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol.
What is the SMILES notation for 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol?
The canonical SMILES for 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol is OCC(O)COc1cccc2c1cnn2-c1ccnc(NC2CCC(O)CC2)n1.
What is the InChIKey of 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol?
The InChIKey is ATAFJTOBINKREW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N5O4/c26-11-15(28)12-29-18-3-1-2-17-16(18)10-22-25(17)19-8-9-21-20(24-19)23-13-4-6-14(27)7-5-13/h1-3,8-10,13-15,26-28H,4-7,11-12H2,(H,21,23,24).
What are the key properties of 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol?
3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol has a molecular weight of 399.45 g/mol, XLogP of 1.26, 7 rotatable bonds, 4 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[2-[(4-hydroxycyclohexyl)amino]pyrimidin-4-yl]indazol-4-yl]oxypropane-1,2-diol is sourced from PubChem (CID 59743549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).