C18H22BrClN4 — CID 59744262
5-bromo-N-[1-[(2-chloro-4-methylphenyl)methyl]piperidin-4-yl]-4-methylpyrimidin-2-amine (PubChem CID 59744262) has the molecular formula C18H22BrClN4 and a molecular weight of 409.76 g/mol. Its IUPAC name is 5-bromo-N-[1-[(2-chloro-4-methylphenyl)methyl]piperidin-4-yl]-4-methylpyrimidin-2-amine.
| Compound Name | 5-bromo-N-[1-[(2-chloro-4-methylphenyl)methyl]piperidin-4-yl]-4-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 59744262 |
| Molecular Formula | C18H22BrClN4 |
| Molecular Weight | 409.76 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 5-bromo-N-[1-[(2-chloro-4-methylphenyl)methyl]piperidin-4-yl]-4-methylpyrimidin-2-amine |
| SMILES | Cc1ccc(CN2CCC(Nc3ncc(Br)c(C)n3)CC2)c(Cl)c1 |
| InChI | InChI=1S/C18H22BrClN4/c1-12-3-4-14(17(20)9-12)11-24-7-5-15(6-8-24)23-18-21-10-16(19)13(2)22-18/h3-4,9-10,15H,5-8,11H2,1-2H3,(H,21,22,23) |
| InChIKey | ZVSIZHQFTDKOJJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.76 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |