C23H19ClN2O5S2 — CID 59744314
3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid (PubChem CID 59744314) has the molecular formula C23H19ClN2O5S2 and a molecular weight of 503.00 g/mol. Its IUPAC name is 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid.
| Compound Name | 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid |
|---|---|
| PubChem CID | 59744314 |
| Molecular Formula | C23H19ClN2O5S2 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.04 |
| IUPAC Name | 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylic acid |
| SMILES | COc1ccc(-c2c(Cl)c(CN3C(=O)CSC3=O)nc3sc4c(c23)CCC(C(=O)O)C4)cc1 |
| InChI | InChI=1S/C23H19ClN2O5S2/c1-31-13-5-2-11(3-6-13)18-19-14-7-4-12(22(28)29)8-16(14)33-21(19)25-15(20(18)24)9-26-17(27)10-32-23(26)30/h2-3,5-6,12H,4,7-10H2,1H3,(H,28,29) |
| InChIKey | KLIYDJQJDQNXRC-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|