C25H23ClN2O5S2 — CID 59744316
ethyl 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylate (PubChem CID 59744316) has the molecular formula C25H23ClN2O5S2 and a molecular weight of 531.06 g/mol. Its IUPAC name is ethyl 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylate.
| Compound Name | ethyl 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 59744316 |
| Molecular Formula | C25H23ClN2O5S2 |
| Molecular Weight | 531.06 g/mol |
| Exact Mass | 530.07 |
| IUPAC Name | ethyl 3-chloro-2-[(2,4-dioxo-1,3-thiazolidin-3-yl)methyl]-4-(4-methoxyphenyl)-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-b]pyridine-7-carboxylate |
| SMILES | CCOC(=O)C1CCc2c(sc3nc(CN4C(=O)CSC4=O)c(Cl)c(-c4ccc(OC)cc4)c23)C1 |
| InChI | InChI=1S/C25H23ClN2O5S2/c1-3-33-24(30)14-6-9-16-18(10-14)35-23-21(16)20(13-4-7-15(32-2)8-5-13)22(26)17(27-23)11-28-19(29)12-34-25(28)31/h4-5,7-8,14H,3,6,9-12H2,1-2H3 |
| InChIKey | AWAUNJVOEOPIJX-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.06 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|