About [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone
[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone (PubChem CID 59744791) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone.
Molecular Properties
| Compound Name | [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone |
| PubChem CID | 59744791 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone |
| SMILES | CC(C)(C)CCC1(C(=O)c2ccc3[nH]ccc3c2)CCNC1 |
| InChI | InChI=1S/C19H26N2O/c1-18(2,3)7-8-19(9-11-20-13-19)17(22)15-4-5-16-14(12-15)6-10-21-16/h4-6,10,12,20-21H,7-9,11,13H2,1-3H3 |
| InChIKey | UBAFWEAUURTRJS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone?
The IUPAC name of [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone (CID 59744791) is [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone.
What is the SMILES notation for [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone?
The canonical SMILES for [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone is CC(C)(C)CCC1(C(=O)c2ccc3[nH]ccc3c2)CCNC1.
What is the InChIKey of [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone?
The InChIKey is UBAFWEAUURTRJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-18(2,3)7-8-19(9-11-20-13-19)17(22)15-4-5-16-14(12-15)6-10-21-16/h4-6,10,12,20-21H,7-9,11,13H2,1-3H3.
What are the key properties of [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone?
[3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone has a molecular weight of 298.43 g/mol, XLogP of 4.16, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,3-dimethylbutyl)pyrrolidin-3-yl]-(1H-indol-5-yl)methanone is sourced from PubChem (CID 59744791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).