About (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone
(3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone (PubChem CID 59744818) has the molecular formula C14H13Cl2F2NO
and a molecular weight of 320.17 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone.
Molecular Properties
| Compound Name | (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone |
| PubChem CID | 59744818 |
| Molecular Formula | C14H13Cl2F2NO |
| Molecular Weight | 320.17 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1(CC=C(F)F)CCCN1 |
| InChI | InChI=1S/C14H13Cl2F2NO/c15-10-3-2-9(8-11(10)16)13(20)14(5-1-7-19-14)6-4-12(17)18/h2-4,8,19H,1,5-7H2 |
| InChIKey | LKKYXGCPJNZTFX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.17 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone?
The IUPAC name of (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone (CID 59744818) is (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone.
What is the SMILES notation for (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone?
The canonical SMILES for (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone is O=C(c1ccc(Cl)c(Cl)c1)C1(CC=C(F)F)CCCN1.
What is the InChIKey of (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone?
The InChIKey is LKKYXGCPJNZTFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Cl2F2NO/c15-10-3-2-9(8-11(10)16)13(20)14(5-1-7-19-14)6-4-12(17)18/h2-4,8,19H,1,5-7H2.
What are the key properties of (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone?
(3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone has a molecular weight of 320.17 g/mol, XLogP of 4.47, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dichlorophenyl)-[2-(3,3-difluoroprop-2-enyl)pyrrolidin-2-yl]methanone is sourced from PubChem (CID 59744818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).