C23H20FN3O2 — CID 59744986
ethyl 6-(2-cyanophenyl)-4-[2-(3-fluorophenyl)ethylamino]pyridine-3-carboxylate (PubChem CID 59744986) has the molecular formula C23H20FN3O2 and a molecular weight of 389.43 g/mol. Its IUPAC name is ethyl 6-(2-cyanophenyl)-4-[2-(3-fluorophenyl)ethylamino]pyridine-3-carboxylate.
| Compound Name | ethyl 6-(2-cyanophenyl)-4-[2-(3-fluorophenyl)ethylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59744986 |
| Molecular Formula | C23H20FN3O2 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | ethyl 6-(2-cyanophenyl)-4-[2-(3-fluorophenyl)ethylamino]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cnc(-c2ccccc2C#N)cc1NCCc1cccc(F)c1 |
| InChI | InChI=1S/C23H20FN3O2/c1-2-29-23(28)20-15-27-21(19-9-4-3-7-17(19)14-25)13-22(20)26-11-10-16-6-5-8-18(24)12-16/h3-9,12-13,15H,2,10-11H2,1H3,(H,26,27) |
| InChIKey | JJVDSMMQMLICKR-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |