C20H22F3NO — CID 59745025
N-methyl-2-[4-[4-[2-(trifluoromethyl)phenyl]butyl]phenyl]acetamide (PubChem CID 59745025) has the molecular formula C20H22F3NO and a molecular weight of 349.40 g/mol. Its IUPAC name is N-methyl-2-[4-[4-[2-(trifluoromethyl)phenyl]butyl]phenyl]acetamide.
| Compound Name | N-methyl-2-[4-[4-[2-(trifluoromethyl)phenyl]butyl]phenyl]acetamide |
|---|---|
| PubChem CID | 59745025 |
| Molecular Formula | C20H22F3NO |
| Molecular Weight | 349.40 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-methyl-2-[4-[4-[2-(trifluoromethyl)phenyl]butyl]phenyl]acetamide |
| SMILES | CNC(=O)Cc1ccc(CCCCc2ccccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO/c1-24-19(25)14-16-12-10-15(11-13-16)6-2-3-7-17-8-4-5-9-18(17)20(21,22)23/h4-5,8-13H,2-3,6-7,14H2,1H3,(H,24,25) |
| InChIKey | IFFWTYRWZSLATM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|