C6H12N2O3S — CID 59745131
(3S)-3-methyl-1,1-dioxo-1,2,5-thiadiazocan-4-one (PubChem CID 59745131) has the molecular formula C6H12N2O3S and a molecular weight of 192.24 g/mol. Its IUPAC name is (3S)-3-methyl-1,1-dioxo-1,2,5-thiadiazocan-4-one.
| Compound Name | (3S)-3-methyl-1,1-dioxo-1,2,5-thiadiazocan-4-one |
|---|---|
| PubChem CID | 59745131 |
| Molecular Formula | C6H12N2O3S |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (3S)-3-methyl-1,1-dioxo-1,2,5-thiadiazocan-4-one |
| SMILES | C[C@@H]1NS(=O)(=O)CCCNC1=O |
| InChI | InChI=1S/C6H12N2O3S/c1-5-6(9)7-3-2-4-12(10,11)8-5/h5,8H,2-4H2,1H3,(H,7,9)/t5-/m0/s1 |
| InChIKey | KNBXHWSKJMMZJV-YFKPBYRVSA-N |
| XLogP | -1.19 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |