C7H14N2O6S — CID 59745200
(3S)-3-amino-4-oxo-4-(3-sulfopropylamino)butanoic acid (PubChem CID 59745200) has the molecular formula C7H14N2O6S and a molecular weight of 254.26 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-(3-sulfopropylamino)butanoic acid.
| Compound Name | (3S)-3-amino-4-oxo-4-(3-sulfopropylamino)butanoic acid |
|---|---|
| PubChem CID | 59745200 |
| Molecular Formula | C7H14N2O6S |
| Molecular Weight | 254.26 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-(3-sulfopropylamino)butanoic acid |
| SMILES | N[C@@H](CC(=O)O)C(=O)NCCCS(=O)(=O)O |
| InChI | InChI=1S/C7H14N2O6S/c8-5(4-6(10)11)7(12)9-2-1-3-16(13,14)15/h5H,1-4,8H2,(H,9,12)(H,10,11)(H,13,14,15)/t5-/m0/s1 |
| InChIKey | BORRCKWZTYBWGQ-YFKPBYRVSA-N |
| XLogP | -1.82 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.26 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|