About ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate
ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate (PubChem CID 59745249) has the molecular formula C12H12N2O5
and a molecular weight of 264.24 g/mol. Its IUPAC name is ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate |
| PubChem CID | 59745249 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate |
| SMILES | CCOC(=O)Nc1ccc2c(c1[N+](=O)[O-])CCC2=O |
| InChI | InChI=1S/C12H12N2O5/c1-2-19-12(16)13-9-5-3-7-8(4-6-10(7)15)11(9)14(17)18/h3,5H,2,4,6H2,1H3,(H,13,16) |
| InChIKey | VPTSJUAXKUKAID-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate?
The IUPAC name of ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate (CID 59745249) is ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate.
What is the SMILES notation for ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate?
The canonical SMILES for ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate is CCOC(=O)Nc1ccc2c(c1[N+](=O)[O-])CCC2=O.
What is the InChIKey of ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate?
The InChIKey is VPTSJUAXKUKAID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5/c1-2-19-12(16)13-9-5-3-7-8(4-6-10(7)15)11(9)14(17)18/h3,5H,2,4,6H2,1H3,(H,13,16).
What are the key properties of ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate?
ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate has a molecular weight of 264.24 g/mol, XLogP of 2.29, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(4-nitro-1-oxo-2,3-dihydroinden-5-yl)carbamate is sourced from PubChem (CID 59745249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).