C19H27N3O3 — CID 59745322
(1,2,2,6,6-pentamethylpiperidin-4-yl) N-(3-isocyanato-2-methylphenyl)carbamate (PubChem CID 59745322) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) N-(3-isocyanato-2-methylphenyl)carbamate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) N-(3-isocyanato-2-methylphenyl)carbamate |
|---|---|
| PubChem CID | 59745322 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) N-(3-isocyanato-2-methylphenyl)carbamate |
| SMILES | Cc1c(N=C=O)cccc1NC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C19H27N3O3/c1-13-15(20-12-23)8-7-9-16(13)21-17(24)25-14-10-18(2,3)22(6)19(4,5)11-14/h7-9,14H,10-11H2,1-6H3,(H,21,24) |
| InChIKey | JOZUOPOLRUBVBL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|