About tricyclo[5.2.1.02,6]decane-4,8-dithiol
tricyclo[5.2.1.02,6]decane-4,8-dithiol (PubChem CID 59745396) has the molecular formula C10H16S2
and a molecular weight of 200.37 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]decane-4,8-dithiol.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]decane-4,8-dithiol |
| PubChem CID | 59745396 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | tricyclo[5.2.1.02,6]decane-4,8-dithiol |
| SMILES | SC1CC2C3CC(S)C(C3)C2C1 |
| InChI | InChI=1S/C10H16S2/c11-6-3-7-5-1-9(8(7)4-6)10(12)2-5/h5-12H,1-4H2 |
| InChIKey | NUBNEAWVWCUMQZ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]decane-4,8-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]decane-4,8-dithiol?
The IUPAC name of tricyclo[5.2.1.02,6]decane-4,8-dithiol (CID 59745396) is tricyclo[5.2.1.02,6]decane-4,8-dithiol.
What is the SMILES notation for tricyclo[5.2.1.02,6]decane-4,8-dithiol?
The canonical SMILES for tricyclo[5.2.1.02,6]decane-4,8-dithiol is SC1CC2C3CC(S)C(C3)C2C1.
What is the InChIKey of tricyclo[5.2.1.02,6]decane-4,8-dithiol?
The InChIKey is NUBNEAWVWCUMQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16S2/c11-6-3-7-5-1-9(8(7)4-6)10(12)2-5/h5-12H,1-4H2.
What are the key properties of tricyclo[5.2.1.02,6]decane-4,8-dithiol?
tricyclo[5.2.1.02,6]decane-4,8-dithiol has a molecular weight of 200.37 g/mol, XLogP of 2.65, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]decane-4,8-dithiol is sourced from PubChem (CID 59745396), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).