C27H43NO8 — CID 59745764
6-[(2S,4S,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-(7-methyl-6-oxooctoxy)oxan-2-yl]oxy-N-phenylhexanamide (PubChem CID 59745764) has the molecular formula C27H43NO8 and a molecular weight of 509.64 g/mol. Its IUPAC name is 6-[(2S,4S,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-(7-methyl-6-oxooctoxy)oxan-2-yl]oxy-N-phenylhexanamide.
| Compound Name | 6-[(2S,4S,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-(7-methyl-6-oxooctoxy)oxan-2-yl]oxy-N-phenylhexanamide |
|---|---|
| PubChem CID | 59745764 |
| Molecular Formula | C27H43NO8 |
| Molecular Weight | 509.64 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | 6-[(2S,4S,5S)-3,4-dihydroxy-6-(hydroxymethyl)-5-(7-methyl-6-oxooctoxy)oxan-2-yl]oxy-N-phenylhexanamide |
| SMILES | CC(C)C(=O)CCCCCO[C@@H]1C(CO)O[C@H](OCCCCCC(=O)Nc2ccccc2)C(O)[C@@H]1O |
| InChI | InChI=1S/C27H43NO8/c1-19(2)21(30)14-8-4-10-16-34-26-22(18-29)36-27(25(33)24(26)32)35-17-11-5-9-15-23(31)28-20-12-6-3-7-13-20/h3,6-7,12-13,19,22,24-27,29,32-33H,4-5,8-11,14-18H2,1-2H3,(H,28,31)/t22?,24-,25?,26+,27-/m0/s1 |
| InChIKey | KXAWEAMWAGYCJL-RGCAUWNHSA-N |
| XLogP | 2.81 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.64 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|