About 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline
4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline (PubChem CID 59746476) has the molecular formula C18H30N2O
and a molecular weight of 290.45 g/mol. Its IUPAC name is 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline |
| PubChem CID | 59746476 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(CN2CCOCC2)C(C)(C)C)cc1 |
| InChI | InChI=1S/C18H30N2O/c1-18(2,3)17(14-20-10-12-21-13-11-20)15-6-8-16(9-7-15)19(4)5/h6-9,17H,10-14H2,1-5H3 |
| InChIKey | ZCSZXHNZXLCTBV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|
Analyze 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline?
The IUPAC name of 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline (CID 59746476) is 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline.
What is the SMILES notation for 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline?
The canonical SMILES for 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline is CN(C)c1ccc(C(CN2CCOCC2)C(C)(C)C)cc1.
What is the InChIKey of 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline?
The InChIKey is ZCSZXHNZXLCTBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2O/c1-18(2,3)17(14-20-10-12-21-13-11-20)15-6-8-16(9-7-15)19(4)5/h6-9,17H,10-14H2,1-5H3.
What are the key properties of 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline?
4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline has a molecular weight of 290.45 g/mol, XLogP of 3.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethyl-1-morpholin-4-ylbutan-2-yl)-N,N-dimethylaniline is sourced from PubChem (CID 59746476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).