C57H47N3 — CID 59747301
8-(5,5-dimethylindeno[1,2-b]pyridin-8-yl)-2-[7-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-9,9-dimethylfluoren-2-yl]-5,5-dimethylindeno[1,2-b]pyridine (PubChem CID 59747301) has the molecular formula C57H47N3 and a molecular weight of 774.02 g/mol. Its IUPAC name is 8-(5,5-dimethylindeno[1,2-b]pyridin-8-yl)-2-[7-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-9,9-dimethylfluoren-2-yl]-5,5-dimethylindeno[1,2-b]pyridine.
| Compound Name | 8-(5,5-dimethylindeno[1,2-b]pyridin-8-yl)-2-[7-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-9,9-dimethylfluoren-2-yl]-5,5-dimethylindeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 59747301 |
| Molecular Formula | C57H47N3 |
| Molecular Weight | 774.02 g/mol |
| Exact Mass | 773.38 |
| IUPAC Name | 8-(5,5-dimethylindeno[1,2-b]pyridin-8-yl)-2-[7-(5,5-dimethylindeno[1,2-b]pyridin-2-yl)-9,9-dimethylfluoren-2-yl]-5,5-dimethylindeno[1,2-b]pyridine |
| SMILES | CC1(C)c2cc(-c3ccc4c(n3)-c3ccccc3C4(C)C)ccc2-c2ccc(-c3ccc4c(n3)-c3cc(-c5ccc6c(c5)-c5ncccc5C6(C)C)ccc3C4(C)C)cc21 |
| InChI | InChI=1S/C57H47N3/c1-54(2)41-13-10-9-12-38(41)52-45(54)23-25-49(59-52)34-15-19-36-37-20-16-35(31-48(37)57(7,8)47(36)30-34)50-26-24-46-53(60-50)40-29-33(18-22-43(40)56(46,5)6)32-17-21-42-39(28-32)51-44(55(42,3)4)14-11-27-58-51/h9-31H,1-8H3 |
| InChIKey | WDZXGLMHRXMZKJ-UHFFFAOYSA-N |
| XLogP | 14.10 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.02 |
| LogP ≤ 5 | 14.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |