C14H14N2O — CID 59747553
13,15-dimethyl-8-oxa-10,13-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene (PubChem CID 59747553) has the molecular formula C14H14N2O and a molecular weight of 226.28 g/mol. Its IUPAC name is 13,15-dimethyl-8-oxa-10,13-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene.
| Compound Name | 13,15-dimethyl-8-oxa-10,13-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene |
|---|---|
| PubChem CID | 59747553 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 13,15-dimethyl-8-oxa-10,13-diazatetracyclo[7.6.0.02,7.010,14]pentadeca-1(9),2,4,6,11-pentaene |
| SMILES | CC1c2c(oc3ccccc23)N2C=CN(C)C12 |
| InChI | InChI=1S/C14H14N2O/c1-9-12-10-5-3-4-6-11(10)17-14(12)16-8-7-15(2)13(9)16/h3-9,13H,1-2H3 |
| InChIKey | PBOIEVBOZAODBA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 19.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |