C15H28N2O2Si — CID 59747913
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 59747913) has the molecular formula C15H28N2O2Si and a molecular weight of 296.49 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 59747913 |
| Molecular Formula | C15H28N2O2Si |
| Molecular Weight | 296.49 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCCn1ncc2c1CCCC2O |
| InChI | InChI=1S/C15H28N2O2Si/c1-15(2,3)20(4,5)19-10-9-17-13-7-6-8-14(18)12(13)11-16-17/h11,14,18H,6-10H2,1-5H3 |
| InChIKey | MJPOZKUJQAZNDL-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|