C13H14N2 — CID 59747934
(E)-3-[(5S)-5-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enenitrile (PubChem CID 59747934) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is (E)-3-[(5S)-5-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[(5S)-5-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 59747934 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (E)-3-[(5S)-5-amino-5,6,7,8-tetrahydronaphthalen-2-yl]prop-2-enenitrile |
| SMILES | N#C/C=C/c1ccc2c(c1)CCC[C@@H]2N |
| InChI | InChI=1S/C13H14N2/c14-8-2-3-10-6-7-12-11(9-10)4-1-5-13(12)15/h2-3,6-7,9,13H,1,4-5,15H2/b3-2+/t13-/m0/s1 |
| InChIKey | HIITXRUAUMFDAU-IBUXWKBASA-N |
| XLogP | 2.56 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|