C14H14N2 — CID 59748094
tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarbonitrile (PubChem CID 59748094) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarbonitrile.
| Compound Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 59748094 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4,5-dicarbonitrile |
| SMILES | N#CC1C(C#N)C2CC1C1C3C=CC(C3)C21 |
| InChI | InChI=1S/C14H14N2/c15-5-11-9-4-10(12(11)6-16)14-8-2-1-7(3-8)13(9)14/h1-2,7-14H,3-4H2 |
| InChIKey | FJBMDQACDJYODX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|