C34H34IrN2O3-2 — CID 59748546
3-[(4-hydroxyphenyl)methyl]pentane-2,4-diol;iridium;bis(2-phenylpyridine) (PubChem CID 59748546) has the molecular formula C34H34IrN2O3-2 and a molecular weight of 710.87 g/mol. Its IUPAC name is 3-[(4-hydroxyphenyl)methyl]pentane-2,4-diol;iridium;bis(2-phenylpyridine).
| Compound Name | 3-[(4-hydroxyphenyl)methyl]pentane-2,4-diol;iridium;bis(2-phenylpyridine) |
|---|---|
| PubChem CID | 59748546 |
| Molecular Formula | C34H34IrN2O3-2 |
| Molecular Weight | 710.87 g/mol |
| Exact Mass | 711.22 |
| IUPAC Name | 3-[(4-hydroxyphenyl)methyl]pentane-2,4-diol;iridium;bis(2-phenylpyridine) |
| SMILES | CC(O)C(Cc1ccc(O)cc1)C(C)O.[Ir].[c-]1ccccc1-c1ccccn1.[c-]1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C12H18O3.2C11H8N.Ir/c1-8(13)12(9(2)14)7-10-3-5-11(15)6-4-10;2*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3-6,8-9,12-15H,7H2,1-2H3;2*1-6,8-9H;/q;2*-1; |
| InChIKey | XTSCKXMBEPOYKD-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.87 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|