About 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one
10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one (PubChem CID 59748663) has the molecular formula C29H28F3NO
and a molecular weight of 463.54 g/mol. Its IUPAC name is 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one.
Molecular Properties
| Compound Name | 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one |
| PubChem CID | 59748663 |
| Molecular Formula | C29H28F3NO |
| Molecular Weight | 463.54 g/mol |
| Exact Mass | 463.21 |
| IUPAC Name | 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1/N=C1\C(=O)c2ccccc2-c2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C29H28F3NO/c1-27(2,3)22-12-9-13-23(28(4,5)6)25(22)33-24-21-16-17(29(30,31)32)14-15-19(21)18-10-7-8-11-20(18)26(24)34/h7-16H,1-6H3/b33-24- |
| InChIKey | JWJDAQYPOAPRGM-GIBOGKFOSA-N |
| XLogP | 8.28 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.54 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one?
The IUPAC name of 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one (CID 59748663) is 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one.
What is the SMILES notation for 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one?
The canonical SMILES for 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one is CC(C)(C)c1cccc(C(C)(C)C)c1/N=C1\C(=O)c2ccccc2-c2ccc(C(F)(F)F)cc21.
What is the InChIKey of 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one?
The InChIKey is JWJDAQYPOAPRGM-GIBOGKFOSA-N. The full InChI is InChI=1S/C29H28F3NO/c1-27(2,3)22-12-9-13-23(28(4,5)6)25(22)33-24-21-16-17(29(30,31)32)14-15-19(21)18-10-7-8-11-20(18)26(24)34/h7-16H,1-6H3/b33-24-.
What are the key properties of 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one?
10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one has a molecular weight of 463.54 g/mol, XLogP of 8.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-(2,6-ditert-butylphenyl)imino-2-(trifluoromethyl)phenanthren-9-one is sourced from PubChem (CID 59748663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).