C16H18N4O7S2 — CID 59748894
[3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methyl]phenyl]methyl nitrate (PubChem CID 59748894) has the molecular formula C16H18N4O7S2 and a molecular weight of 442.48 g/mol. Its IUPAC name is [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methyl]phenyl]methyl nitrate.
| Compound Name | [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methyl]phenyl]methyl nitrate |
|---|---|
| PubChem CID | 59748894 |
| Molecular Formula | C16H18N4O7S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methyl]phenyl]methyl nitrate |
| SMILES | Cc1cc2c(cc1S(N)(=O)=O)S(=O)(=O)N(Cc1cccc(CO[N+](=O)[O-])c1)CN2 |
| InChI | InChI=1S/C16H18N4O7S2/c1-11-5-14-16(7-15(11)28(17,23)24)29(25,26)19(10-18-14)8-12-3-2-4-13(6-12)9-27-20(21)22/h2-7,18H,8-10H2,1H3,(H2,17,23,24) |
| InChIKey | IMEVJWADVUVNND-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 161.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|