C17H35N — CID 59748907
3,3-ditert-butyl-1,2,2,5,5-pentamethylpyrrolidine (PubChem CID 59748907) has the molecular formula C17H35N and a molecular weight of 253.47 g/mol. Its IUPAC name is 3,3-ditert-butyl-1,2,2,5,5-pentamethylpyrrolidine.
| Compound Name | 3,3-ditert-butyl-1,2,2,5,5-pentamethylpyrrolidine |
|---|---|
| PubChem CID | 59748907 |
| Molecular Formula | C17H35N |
| Molecular Weight | 253.47 g/mol |
| Exact Mass | 253.28 |
| IUPAC Name | 3,3-ditert-butyl-1,2,2,5,5-pentamethylpyrrolidine |
| SMILES | CN1C(C)(C)CC(C(C)(C)C)(C(C)(C)C)C1(C)C |
| InChI | InChI=1S/C17H35N/c1-13(2,3)17(14(4,5)6)12-15(7,8)18(11)16(17,9)10/h12H2,1-11H3 |
| InChIKey | BZURSRBNYLXKMH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.47 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |