C17H19N5O11S2 — CID 59748926
[3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methoxy]-5-(nitrooxymethyl)phenyl]methyl nitrate (PubChem CID 59748926) has the molecular formula C17H19N5O11S2 and a molecular weight of 533.50 g/mol. Its IUPAC name is [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methoxy]-5-(nitrooxymethyl)phenyl]methyl nitrate.
| Compound Name | [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methoxy]-5-(nitrooxymethyl)phenyl]methyl nitrate |
|---|---|
| PubChem CID | 59748926 |
| Molecular Formula | C17H19N5O11S2 |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.05 |
| IUPAC Name | [3-[(6-methyl-1,1-dioxo-7-sulfamoyl-3,4-dihydro-1λ6,2,4-benzothiadiazin-2-yl)methoxy]-5-(nitrooxymethyl)phenyl]methyl nitrate |
| SMILES | Cc1cc2c(cc1S(N)(=O)=O)S(=O)(=O)N(COc1cc(CO[N+](=O)[O-])cc(CO[N+](=O)[O-])c1)CN2 |
| InChI | InChI=1S/C17H19N5O11S2/c1-11-2-15-17(6-16(11)34(18,27)28)35(29,30)20(9-19-15)10-31-14-4-12(7-32-21(23)24)3-13(5-14)8-33-22(25)26/h2-6,19H,7-10H2,1H3,(H2,18,27,28) |
| InChIKey | IROGYSHDNUWUDV-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 223.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|